CAS 888970-79-4 appears in our catalog under these names: 2-(4-Bromophenyl)-2-{((tert-butoxy)carbonyl)amino}propanoic acid, 95%, 2-(4-Bromophenyl)-2-{((tert-butoxy)carbonyl)amino}propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 888970-79-4) is a chemical compound with the molecular formula C14H18BrNO4 and a molecular weight of 344.20 g/mol. IUPAC name: 2-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KXDMYNYXKAUFFF-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO4 |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KXDMYNYXKAUFFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)