Products 88904-00-1
CAS 88904-00-1 is the registry number for Benzyl (S)-4-Oxooxetane-2-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Benzyl (2S)-4-oxooxetane-2-carboxylate (CAS 88904-00-1) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: benzyl (2S)-4-oxooxetane-2-carboxylate. InChIKey: AGYZCBIYODIDEY-VIFPVBQESA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | benzyl (2S)-4-oxooxetane-2-carboxylate |
| InChIKey | AGYZCBIYODIDEY-VIFPVBQESA-N |
| SMILES | C1[C@H](OC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
benzyl (S)-4-oxooxetane-2-carboxylate