Products 88915-31-5
CAS 88915-31-5 is the registry number for N-(2-Nitrophenyl)piperidin-4-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(2-nitrophenyl)piperidin-4-amine;hydrochloride (CAS 88915-31-5) is a chemical compound with the molecular formula C11H16ClN3O2 and a molecular weight of 257.72 g/mol. IUPAC name: N-(2-nitrophenyl)piperidin-4-amine;hydrochloride. InChIKey: SPDXXCNQMLMSQM-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O2 |
|---|---|
| Molecular weight | 257.72 g/mol |
| IUPAC name | N-(2-nitrophenyl)piperidin-4-amine;hydrochloride |
| InChIKey | SPDXXCNQMLMSQM-UHFFFAOYSA-N |
| SMILES | C1CNCCC1NC2=CC=CC=C2[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)