CAS 88918-88-1 is the registry number for 1-(4-Aminophenyl)-N,N-dimethylmethanesulfonamide. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g, 2g.
1-(4-aminophenyl)-N,N-dimethylmethanesulfonamide (CAS 88918-88-1) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: 1-(4-aminophenyl)-N,N-dimethylmethanesulfonamide. InChIKey: DRKYSGDBANPLKH-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | 1-(4-aminophenyl)-N,N-dimethylmethanesulfonamide |
| InChIKey | DRKYSGDBANPLKH-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)CC1=CC=C(C=C1)N |
Computed by PubChem (NCBI)