CAS 889940-53-8 is the registry number for 2-(3-Amino-4-methylphenyl)-1λâ¶,2-thiazolidine-1,1-dione. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylaniline (CAS 889940-53-8) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: 5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylaniline. InChIKey: ZKUMMUCRIGJVIV-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylaniline |
| InChIKey | ZKUMMUCRIGJVIV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2CCCS2(=O)=O)N |
Computed by PubChem (NCBI)