CAS 889974-57-6 is the registry number for (1-(4-Chloro-benzyl)-1H-indol-3-yl)-oxo-acetic acid methyl ester. Offered by: Biosynth. Available pack sizes: 1000mg.
Methyl 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetate (CAS 889974-57-6) is a chemical compound with the molecular formula C18H14ClNO3 and a molecular weight of 327.8 g/mol. IUPAC name: methyl 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetate. InChIKey: BEYXQOAQUIFIMR-UHFFFAOYSA-N.
| Molecular formula | C18H14ClNO3 |
|---|---|
| Molecular weight | 327.8 g/mol |
| IUPAC name | methyl 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetate |
| InChIKey | BEYXQOAQUIFIMR-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C1=CN(C2=CC=CC=C21)CC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)