Products 890098-07-4
CAS 890098-07-4 is the registry number for (2-Chlorophenyl)(3-methoxyphenyl)methanone. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(2-chlorophenyl)-(3-methoxyphenyl)methanone (CAS 890098-07-4) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: (2-chlorophenyl)-(3-methoxyphenyl)methanone. InChIKey: FNIKCZVQKULCBF-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | (2-chlorophenyl)-(3-methoxyphenyl)methanone |
| InChIKey | FNIKCZVQKULCBF-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)