CAS 890134-27-7 is the registry number for 9,9-Dimethyl-9H-fluorene-2-carbonitrile. Offered by: TRC. Available pack sizes: 5g.
9,9-dimethylfluorene-2-carbonitrile (CAS 890134-27-7) is a chemical compound with the molecular formula C16H13N and a molecular weight of 219.28 g/mol. IUPAC name: 9,9-dimethylfluorene-2-carbonitrile. InChIKey: JSISIFNXLUGFSV-UHFFFAOYSA-N.
| Molecular formula | C16H13N |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 9,9-dimethylfluorene-2-carbonitrile |
| InChIKey | JSISIFNXLUGFSV-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)C#N)C |
Computed by PubChem (NCBI)