Products 890981-35-8
CAS 890981-35-8 is the registry number for 2-Cyclopentyl-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-cyclopentyl-1,3-dioxoisoindole-5-carboxylic acid (CAS 890981-35-8) is a chemical compound with the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. IUPAC name: 2-cyclopentyl-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: NFHMPLPCPYIDJD-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 2-cyclopentyl-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | NFHMPLPCPYIDJD-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)