CAS 891188-18-4 is the registry number for 6–Hydroxy–5,7–dimethylspiro(chromene–2,1'–cyclobutan)–4(3H)–one. Offered by: GLPBio. Available pack sizes: 5mg.
6-hydroxy-5,7-dimethylspiro[3H-chromene-2,1'-cyclobutane]-4-one (CAS 891188-18-4) is a chemical compound with the molecular formula C14H16O3 and a molecular weight of 232.27 g/mol. IUPAC name: 6-hydroxy-5,7-dimethylspiro[3H-chromene-2,1'-cyclobutane]-4-one. InChIKey: OYMGBMVJXWRUCF-UHFFFAOYSA-N.
| Molecular formula | C14H16O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | 6-hydroxy-5,7-dimethylspiro[3H-chromene-2,1'-cyclobutane]-4-one |
| InChIKey | OYMGBMVJXWRUCF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1O)C)C(=O)CC3(O2)CCC3 |
Computed by PubChem (NCBI)