CAS 893602-57-8 appears in our catalog under these names: 3-(Cyclopropylsulfonyl)aniline, 98%, 3-(Cyclopropanesulfonyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-cyclopropylsulfonylaniline (CAS 893602-57-8) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 3-cyclopropylsulfonylaniline. InChIKey: STPYCWFQVXRWEW-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 3-cyclopropylsulfonylaniline |
| InChIKey | STPYCWFQVXRWEW-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)