CAS 893727-50-9 appears in our catalog under these names: 5,5-Dimethyl-2-(2-(4-methylphenyl)-2-oxoethyl)cyclohexane-1,3-dione, 95%, 5,5-Dimethyl-2-(2-(4-methylphenyl)-2-oxoethyl)cyclohexane-1,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5,5-dimethyl-2-[2-(4-methylphenyl)-2-oxoethyl]cyclohexane-1,3-dione (CAS 893727-50-9) is a chemical compound with the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. IUPAC name: 5,5-dimethyl-2-[2-(4-methylphenyl)-2-oxoethyl]cyclohexane-1,3-dione. InChIKey: IGQXCNOHYWKSRS-UHFFFAOYSA-N.
| Molecular formula | C17H20O3 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 5,5-dimethyl-2-[2-(4-methylphenyl)-2-oxoethyl]cyclohexane-1,3-dione |
| InChIKey | IGQXCNOHYWKSRS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC2C(=O)CC(CC2=O)(C)C |
Computed by PubChem (NCBI)