CAS 89374-79-8 appears in our catalog under these names: 9-Methyl-9h-carbazole-3-carboxylic acid, 95%, 9-Methyl-9H-carbazole-3-carboxylic Acid, >95% (HPLC), 9-Methyl-9H-carbazole-3-carboxylic acid, 95+%, 9-Methyl-9H-carbazole-3-carboxylic acid, ≥95%, ≥95%, 9-Methyl-9H-carbazole-3-carboxylic acid, ≥95%. Offered by: Combi-blocks, TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 50mg, 25g.
9-methylcarbazole-3-carboxylic acid (CAS 89374-79-8) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: 9-methylcarbazole-3-carboxylic acid. InChIKey: HKCYYHQXRCUSRQ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 9-methylcarbazole-3-carboxylic acid |
| InChIKey | HKCYYHQXRCUSRQ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C(=O)O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)