CAS 893740-24-4 appears in our catalog under these names: Methyl 5-cyclopropylnicotinate, 98%, Methyl 5-cyclopropylnicotinate, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
Methyl 5-cyclopropylpyridine-3-carboxylate (CAS 893740-24-4) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: methyl 5-cyclopropylpyridine-3-carboxylate. InChIKey: IFKBAHVKDUCQJB-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | methyl 5-cyclopropylpyridine-3-carboxylate |
| InChIKey | IFKBAHVKDUCQJB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=CC(=C1)C2CC2 |
Computed by PubChem (NCBI)