Products 89469-46-5
CAS 89469-46-5 appears in our catalog under these names: 3-[Methyl(methylsulfonyl)amino]benzoic acid, 98%, 3-(N-Methylmethylsulfonamido)benzoic acid, 97%, 3-(Methyl(methylsulfonyl)amino)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 500mg, 1000mg, 2000mg.
3-[methyl(methylsulfonyl)amino]benzoic acid (CAS 89469-46-5) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 3-[methyl(methylsulfonyl)amino]benzoic acid. InChIKey: ZOCROBQKZVFBCU-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 3-[methyl(methylsulfonyl)amino]benzoic acid |
| InChIKey | ZOCROBQKZVFBCU-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC(=C1)C(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)