CAS 894853-36-2 is the registry number for 5-Bromo-3,6-dimethyl-1H-indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3,6-dimethyl-1H-indole (CAS 894853-36-2) is a chemical compound with the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. IUPAC name: 5-bromo-3,6-dimethyl-1H-indole. InChIKey: JMXZPKDAKOIVDJ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | 5-bromo-3,6-dimethyl-1H-indole |
| InChIKey | JMXZPKDAKOIVDJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Br)C(=CN2)C |
Computed by PubChem (NCBI)