CAS 895245-32-6 is the registry number for (3R,4R)-tert-Butyl 3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 100mg.
Tert-butyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 895245-32-6) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: tert-butyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: HEFYZXCUGNIOCW-RKDXNWHRSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | HEFYZXCUGNIOCW-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)CO)CO |
Computed by PubChem (NCBI)