CAS 89793-83-9 appears in our catalog under these names: 6-Nitrobenzo[d]isoxazol-3-amine 95%, 6-Nitrobenzo[d]isoxazol-3-amine, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
6-nitro-1,2-benzoxazol-3-amine (CAS 89793-83-9) is a chemical compound with the molecular formula C7H5N3O3 and a molecular weight of 179.13 g/mol. IUPAC name: 6-nitro-1,2-benzoxazol-3-amine. InChIKey: LOKHBIVWILMMIW-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O3 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 6-nitro-1,2-benzoxazol-3-amine |
| InChIKey | LOKHBIVWILMMIW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])ON=C2N |
Computed by PubChem (NCBI)