CAS 89808-76-4 appears in our catalog under these names: 5–(3–Chlorophenyl)oxazole, 5-(3-Chlorophenyl)oxazole 98%, 5-(3-Chlorophenyl)-1,3-oxazole, 98%, 98%, 5-(3-Chlorophenyl)-1,3-oxazole, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
5-(3-chlorophenyl)-1,3-oxazole (CAS 89808-76-4) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 5-(3-chlorophenyl)-1,3-oxazole. InChIKey: NJVHPUNGYNOCQN-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-1,3-oxazole |
| InChIKey | NJVHPUNGYNOCQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CN=CO2 |
Computed by PubChem (NCBI)