Products 898796-62-8
CAS 898796-62-8 appears in our catalog under these names: 5-(4-Trifluoromethoxyphenyl)nicotinic acid, 95%, 5-(4-Trifluoromethoxyphenyl)-nicotinic acid, 95%, 5–(4–Trifluoromethoxyphenyl)–nicotinic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
5-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxylic acid (CAS 898796-62-8) is a chemical compound with the molecular formula C13H8F3NO3 and a molecular weight of 283.20 g/mol. IUPAC name: 5-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxylic acid. InChIKey: ZDGFIIFSNCNIMW-UHFFFAOYSA-N.
| Molecular formula | C13H8F3NO3 |
|---|---|
| Molecular weight | 283.20 g/mol |
| IUPAC name | 5-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxylic acid |
| InChIKey | ZDGFIIFSNCNIMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CN=C2)C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)