CAS 1261956-77-7 appears in our catalog under these names: 2-Nitro-4-(3-trifluoromethylphenyl)phenol, 96%, 3-Nitro-3'-(trifluoromethyl)-(1,1'-biphenyl)-4-ol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-nitro-4-[3-(trifluoromethyl)phenyl]phenol (CAS 1261956-77-7) is a chemical compound with the molecular formula C13H8F3NO3 and a molecular weight of 283.20 g/mol. IUPAC name: 2-nitro-4-[3-(trifluoromethyl)phenyl]phenol. InChIKey: OOJFBHBZPAEWET-UHFFFAOYSA-N.
| Molecular formula | C13H8F3NO3 |
|---|---|
| Molecular weight | 283.20 g/mol |
| IUPAC name | 2-nitro-4-[3-(trifluoromethyl)phenyl]phenol |
| InChIKey | OOJFBHBZPAEWET-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=CC(=C(C=C2)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)