CAS 1355246-94-4 is the registry number for 3-Nitro-4'-(trifluoromethoxy)biphenyl, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-nitro-3-[4-(trifluoromethoxy)phenyl]benzene (CAS 1355246-94-4) is a chemical compound with the molecular formula C13H8F3NO3 and a molecular weight of 283.20 g/mol. IUPAC name: 1-nitro-3-[4-(trifluoromethoxy)phenyl]benzene. InChIKey: CDLJHDSUNJGAPU-UHFFFAOYSA-N.
| Molecular formula | C13H8F3NO3 |
|---|---|
| Molecular weight | 283.20 g/mol |
| IUPAC name | 1-nitro-3-[4-(trifluoromethoxy)phenyl]benzene |
| InChIKey | CDLJHDSUNJGAPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)