CAS 773108-67-1 appears in our catalog under these names: 4-([5-(Trifluoromethyl)pyridin-2-yl]oxy)benzoic acid, 95%, 4-(5-(trifluoromethyl)-2-pyridyloxy)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5000mg.
4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzoic acid (CAS 773108-67-1) is a chemical compound with the molecular formula C13H8F3NO3 and a molecular weight of 283.20 g/mol. IUPAC name: 4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzoic acid. InChIKey: CCNGYKFALZVXHZ-UHFFFAOYSA-N.
| Molecular formula | C13H8F3NO3 |
|---|---|
| Molecular weight | 283.20 g/mol |
| IUPAC name | 4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzoic acid |
| InChIKey | CCNGYKFALZVXHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=NC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)