Products 869109-14-8

CAS 869109-14-8 is the registry number for 4-([4-(Trifluoromethyl)pyridin-2-yl]oxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]benzoic acid (CAS 869109-14-8) is a chemical compound with the molecular formula C13H8F3NO3 and a molecular weight of 283.20 g/mol. IUPAC name: 4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]benzoic acid. InChIKey: HFJHPBHICQXUBD-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8F3NO3
Molecular weight283.20 g/mol
IUPAC name4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]benzoic acid
InChIKeyHFJHPBHICQXUBD-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)O)OC2=NC=CC(=C2)C(F)(F)F

Computed by PubChem (NCBI)