Products 89895-48-7

CAS 89895-48-7 is the registry number for 2-Amino-6-heptenoic Acid Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-aminohept-6-enoic acid;hydrochloride (CAS 89895-48-7) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: 2-aminohept-6-enoic acid;hydrochloride. InChIKey: LDRPPHPKLBBNAB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC name2-aminohept-6-enoic acid;hydrochloride
InChIKeyLDRPPHPKLBBNAB-UHFFFAOYSA-N
SMILESC=CCCCC(C(=O)O)N.Cl

Computed by PubChem (NCBI)