Products 89900-99-2
CAS 89900-99-2 appears in our catalog under these names: Methyl 2'-methyl-[1,1'-biphenyl]-4-carboxylate, 98%, 2'-Methyl-[1,1'-biphenyl]-4-carboxylic acid methyl ester, 95%, Methyl 2'-methyl-[1,1'-biphenyl]-4-carboxylate, ≥96.6%, ≥96.6%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 5g.
Methyl 4-(2-methylphenyl)benzoate (CAS 89900-99-2) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: methyl 4-(2-methylphenyl)benzoate. InChIKey: WBJSBOHFQLCHGX-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | methyl 4-(2-methylphenyl)benzoate |
| InChIKey | WBJSBOHFQLCHGX-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Methyl 4-(2-methylphenyl)benzoate, methyl 2'-methyl-[1,1'-biphenyl]-4-carboxylate, 2'-methyl-[1,1'-biphenyl]-4-carboxylic acid methyl ester, 4-(2-methylphenyl)benzoic acid methyl ester, methyl 2'-methyl[1,1'-biphenyl]-4-carboxylate, 4-methyloxycarbonyl-2'-methyl-1,1'-biphenyl, methyl 4-(o-tolyl)benzoate, WBJSBOHFQLCHGX-UHFFFAOYSA-N, 2'-Methylbiphenyl-4-carboxylic acid methyl ester, 2'-methyl biphenyl-4-carboxylic acid methyl ester