Products 90004-80-1
CAS 90004-80-1 appears in our catalog under these names: 2–(3–Bromo–4–chlorophenyl)acetic acid, 2-(3-Bromo-4-chlorophenyl)acetic acid, 2-(3-Bromo-4-chlorophenyl)acetic acid 97%, 2-(3-Bromo-4-chlorophenyl)acetic acid, 98%, 98%, (3-Bromo-4-chloro-phenyl)-acetic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 50g, 500g, 250mg, 1g, 25g, 100g.
2-(3-bromo-4-chlorophenyl)acetic acid (CAS 90004-80-1) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 2-(3-bromo-4-chlorophenyl)acetic acid. InChIKey: HSOHUCYEOZTHFH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 2-(3-bromo-4-chlorophenyl)acetic acid |
| InChIKey | HSOHUCYEOZTHFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)Br)Cl |
Computed by PubChem (NCBI)