Products 90044-46-5
CAS 90044-46-5 is the registry number for Droxidopa Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
17-azatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene-4,5,12,13-tetrol (CAS 90044-46-5) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: 17-azatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene-4,5,12,13-tetrol. InChIKey: FXFLVMCXSZBKTH-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 17-azatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene-4,5,12,13-tetrol |
| InChIKey | FXFLVMCXSZBKTH-UHFFFAOYSA-N |
| SMILES | C1C2C3=CC(=C(C=C3CC(N2)C4=CC(=C(C=C41)O)O)O)O |
Computed by PubChem (NCBI)