CAS 900449-76-5 appears in our catalog under these names: 2-(Hydroxymethyl)-5-phenyl-3H,4H-thieno(2,3-d)pyrimidin-4-one, 98%, 2-(Hydroxymethyl)-5-phenyl-3H,4H-thieno(2,3-d)pyrimidin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(hydroxymethyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 900449-76-5) is a chemical compound with the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. IUPAC name: 2-(hydroxymethyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: LIOOSSKXGJFYIJ-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 2-(hydroxymethyl)-5-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | LIOOSSKXGJFYIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=C2C(=O)NC(=N3)CO |
Computed by PubChem (NCBI)