Products 901417-87-6
CAS 901417-87-6 is the registry number for 4-Ethyl 1-(4-carboxyphenyl)-5-hydroxy-1H-pyrazole-4-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(4-ethoxycarbonyl-3-oxo-1H-pyrazol-2-yl)benzoic acid (CAS 901417-87-6) is a chemical compound with the molecular formula C13H12N2O5 and a molecular weight of 276.24 g/mol. IUPAC name: 4-(4-ethoxycarbonyl-3-oxo-1H-pyrazol-2-yl)benzoic acid. InChIKey: BAWLSTXVAJBYHT-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O5 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | 4-(4-ethoxycarbonyl-3-oxo-1H-pyrazol-2-yl)benzoic acid |
| InChIKey | BAWLSTXVAJBYHT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNN(C1=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)