Products 902959-52-8
CAS 902959-52-8 is the registry number for LC3B ligand 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-benzyl-1H-pyrido[2,3-d]pyrimidine-2,4-dione (CAS 902959-52-8) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 3-benzyl-1H-pyrido[2,3-d]pyrimidine-2,4-dione. InChIKey: YLODREUTFHMXIW-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 3-benzyl-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
| InChIKey | YLODREUTFHMXIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C3=C(NC2=O)N=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
ChemDiv3_010803, orb2944807