Products 90322-41-1

CAS 90322-41-1 appears in our catalog under these names: 5–Methoxybenzo(d)thiazole–2–carboxylic acid, 5-Methoxybenzo[d]thiazole-2-carboxylic acid, 95%, 95%, 5-Methoxybenzo[d]thiazole-2-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-methoxy-1,3-benzothiazole-2-carboxylic acid (CAS 90322-41-1) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: 5-methoxy-1,3-benzothiazole-2-carboxylic acid. InChIKey: HZCUQHHEHCKENU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7NO3S
Molecular weight209.22 g/mol
IUPAC name5-methoxy-1,3-benzothiazole-2-carboxylic acid
InChIKeyHZCUQHHEHCKENU-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)SC(=N2)C(=O)O

Computed by PubChem (NCBI)