CAS 90322-41-1 appears in our catalog under these names: 5–Methoxybenzo(d)thiazole–2–carboxylic acid, 5-Methoxybenzo[d]thiazole-2-carboxylic acid, 95%, 95%, 5-Methoxybenzo[d]thiazole-2-carboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-methoxy-1,3-benzothiazole-2-carboxylic acid (CAS 90322-41-1) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: 5-methoxy-1,3-benzothiazole-2-carboxylic acid. InChIKey: HZCUQHHEHCKENU-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 5-methoxy-1,3-benzothiazole-2-carboxylic acid |
| InChIKey | HZCUQHHEHCKENU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)SC(=N2)C(=O)O |
Computed by PubChem (NCBI)