CAS 90326-61-7 appears in our catalog under these names: 5–Bromo–2–methoxy–4–methylbenzoic acid, 5-bromo-2-methoxy-4-methylbenzoic acid, 5-Bromo-2-methoxy-4-methylbenzoic acid 95%, 5-Bromo-2-methoxy-4-methylbenzoic acid, 97%, 97%, 5-Bromo-2-methoxy-4-methylbenzoic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
5-bromo-2-methoxy-4-methylbenzoic acid (CAS 90326-61-7) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 5-bromo-2-methoxy-4-methylbenzoic acid. InChIKey: JQSRUIYBQNPWQR-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 5-bromo-2-methoxy-4-methylbenzoic acid |
| InChIKey | JQSRUIYBQNPWQR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C(=O)O)OC |
Computed by PubChem (NCBI)