Products 904686-95-9
CAS 904686-95-9 is the registry number for Methyl 1-isopropyl-2-methyl-1,3-benzodiazole-5-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
Methyl 2-methyl-1-propan-2-ylbenzimidazole-5-carboxylate (CAS 904686-95-9) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: methyl 2-methyl-1-propan-2-ylbenzimidazole-5-carboxylate. InChIKey: WLTJFLMJMFOWKP-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | methyl 2-methyl-1-propan-2-ylbenzimidazole-5-carboxylate |
| InChIKey | WLTJFLMJMFOWKP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C(C)C)C=CC(=C2)C(=O)OC |
Computed by PubChem (NCBI)