CAS 90561-74-3 appears in our catalog under these names: 3-(4-Bromophenyl)azetidine HCl, 3-(4-Bromophenyl)azetidine hydrochloride, 95%, 3-(4-Bromophenyl)azetidine hydrochloride, 97%, 3-(4-BROMOPHENYL)AZETIDINE HCL, 95%, 3-(4-Bromophenyl)azetidine hydrochloride, 96%, 96%. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 0,5g, 50mg, 250mg, 1g, 5g, 10g, 100mg, 500mg.
3-(4-bromophenyl)azetidine;hydrochloride (CAS 90561-74-3) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: 3-(4-bromophenyl)azetidine;hydrochloride. InChIKey: PUUADIQWLUEDNH-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | 3-(4-bromophenyl)azetidine;hydrochloride |
| InChIKey | PUUADIQWLUEDNH-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)