CAS 90610-67-6 is the registry number for N-Methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
N-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (CAS 90610-67-6) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: N-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide. InChIKey: PTQOHBUFHOTLIZ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | N-methyl-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| InChIKey | PTQOHBUFHOTLIZ-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC2=C(C=C1)OCCO2 |
Computed by PubChem (NCBI)