Products 90610-74-5
CAS 90610-74-5 is the registry number for 4-Methyl-3-(n-methylsulfamoyl)benzoic acid, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
4-methyl-3-(methylsulfamoyl)benzoic acid (CAS 90610-74-5) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 4-methyl-3-(methylsulfamoyl)benzoic acid. InChIKey: JUIYSGNFARQFAY-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 4-methyl-3-(methylsulfamoyl)benzoic acid |
| InChIKey | JUIYSGNFARQFAY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)NC |
Computed by PubChem (NCBI)