Products 907583-51-1
CAS 907583-51-1 is the registry number for Musellactone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
8-hydroxy-7-methoxy-4,5-dihydro-3aH-benzo[e][1]benzofuran-2-one (CAS 907583-51-1) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: 8-hydroxy-7-methoxy-4,5-dihydro-3aH-benzo[e][1]benzofuran-2-one. InChIKey: YSIXDHZMGCCQOK-UHFFFAOYSA-N.
| Molecular formula | C13H12O4 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 8-hydroxy-7-methoxy-4,5-dihydro-3aH-benzo[e][1]benzofuran-2-one |
| InChIKey | YSIXDHZMGCCQOK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCC3C2=CC(=O)O3)O |
Computed by PubChem (NCBI)