CAS 907973-15-3 appears in our catalog under these names: 5-Phenylpiperazin-2-one, 95%, 5-Phenylpiperazin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-phenylpiperazin-2-one (CAS 907973-15-3) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 5-phenylpiperazin-2-one. InChIKey: RMZGIXQVAQTNNP-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 5-phenylpiperazin-2-one |
| InChIKey | RMZGIXQVAQTNNP-UHFFFAOYSA-N |
| SMILES | C1C(NCC(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)