CAS 907990-49-2 appears in our catalog under these names: 3-(1-Ethyl-3-methyl-1 H -pyrazol-4-yl)-4,5-dihydro-isoxazole-5-carboxylic acid, 3-(1-Ethyl-3-methyl-1 H -pyrazol-4-yl)-4,5-dihydro-isoxazole-5-carboxylic acid, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 0,5g, 50mg, 1g.
3-(1-ethyl-3-methylpyrazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 907990-49-2) is a chemical compound with the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. IUPAC name: 3-(1-ethyl-3-methylpyrazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: LYRJXIFYUNHGKG-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O3 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 3-(1-ethyl-3-methylpyrazol-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | LYRJXIFYUNHGKG-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=N1)C)C2=NOC(C2)C(=O)O |
Computed by PubChem (NCBI)