Products 90902-21-9
CAS 90902-21-9 appears in our catalog under these names: Broussonin E, Broussonin E, Broussonin E, 98.11%, Broussonin E, 96%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 10mM (in 1ml dmso), 50mg, 10 mg, 5 mg.
5-[3-(2-hydroxy-4-methoxyphenyl)propyl]-2-methoxyphenol (CAS 90902-21-9) is a chemical compound with the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. IUPAC name: 5-[3-(2-hydroxy-4-methoxyphenyl)propyl]-2-methoxyphenol. InChIKey: GDCSYNUJDYRGRF-UHFFFAOYSA-N.
| Molecular formula | C17H20O4 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | 5-[3-(2-hydroxy-4-methoxyphenyl)propyl]-2-methoxyphenol |
| InChIKey | GDCSYNUJDYRGRF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CCCC2=CC(=C(C=C2)OC)O)O |
Computed by PubChem (NCBI)