CAS 90915-18-7 appears in our catalog under these names: 1,2-Dimethylbenzodiazole-5-carboxylic acid, 98%, 1,2-Dimethylbenzodiazole-5-carboxylic acid, 1,2-Dimethyl-1H-benzoimidazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100g.
1,2-dimethylbenzimidazole-5-carboxylic acid (CAS 90915-18-7) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 1,2-dimethylbenzimidazole-5-carboxylic acid. InChIKey: YEOZQWRDUXNFTF-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 1,2-dimethylbenzimidazole-5-carboxylic acid |
| InChIKey | YEOZQWRDUXNFTF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)