CAS 90917-86-5 appears in our catalog under these names: 1-Phenyl-piperazin-2-one, 95%, 1-Phenyl-piperazin-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 1000mg, 2000mg, 5000mg.
1-phenylpiperazin-2-one (CAS 90917-86-5) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 1-phenylpiperazin-2-one. InChIKey: YWUNGYFXNDOGNZ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-phenylpiperazin-2-one |
| InChIKey | YWUNGYFXNDOGNZ-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)