CAS 90922-71-7 appears in our catalog under these names: Methyl 2,3-dimethyl-5-nitrobenzoate, 95%, Methyl 2,3-dimethyl-5-nitrobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Methyl 2,3-dimethyl-5-nitrobenzoate (CAS 90922-71-7) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: methyl 2,3-dimethyl-5-nitrobenzoate. InChIKey: DULYKGKWIIYWPY-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | methyl 2,3-dimethyl-5-nitrobenzoate |
| InChIKey | DULYKGKWIIYWPY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)