CAS 90922-74-0 is the registry number for Methyl 4,5-dimethyl-2-nitrobenzoate, 96%. Offered by: AmBeed. Available pack sizes: 5g, 25g.
Methyl 4,5-dimethyl-2-nitrobenzoate (CAS 90922-74-0) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: methyl 4,5-dimethyl-2-nitrobenzoate. InChIKey: BDRRSVADGVAMQA-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | methyl 4,5-dimethyl-2-nitrobenzoate |
| InChIKey | BDRRSVADGVAMQA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)