Products 909709-43-9
CAS 909709-43-9 appears in our catalog under these names: (S)-3-Amino-3-(3,4-dichlorophenyl)propanoic acid, 97%, 97%, (S)-3-Amino-3-(3,4-dichlorophenyl)propanoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3S)-3-amino-3-(3,4-dichlorophenyl)propanoic acid (CAS 909709-43-9) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: (3S)-3-amino-3-(3,4-dichlorophenyl)propanoic acid. InChIKey: ACJWNKAQMZQVBW-QMMMGPOBSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | (3S)-3-amino-3-(3,4-dichlorophenyl)propanoic acid |
| InChIKey | ACJWNKAQMZQVBW-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1[C@H](CC(=O)O)N)Cl)Cl |
Computed by PubChem (NCBI)