CAS 90971-89-4 appears in our catalog under these names: 2-(4-Bromo-3-methylphenoxy)acetic acid, 2-(4-Bromo-3-methylphenoxy)acetic acid, 95%, 2-(4-Bromo-3-methylphenoxy)acetic acid, 97%, 2-(4-BROMO-3-METHYLPHENOXY)ACETIC ACID, 97%, 97%. Offered by: Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 5g, 0,5g, 1g, 50mg, 100mg, 250mg, 500mg, 2.5g.
2-(4-bromo-3-methylphenoxy)acetic acid (CAS 90971-89-4) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-(4-bromo-3-methylphenoxy)acetic acid. InChIKey: XBWSIQZJWUSHEH-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-(4-bromo-3-methylphenoxy)acetic acid |
| InChIKey | XBWSIQZJWUSHEH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC(=O)O)Br |
Computed by PubChem (NCBI)