Products 910400-40-7
CAS 910400-40-7 is the registry number for 2-(6-Fluoro-2,4-dihydro-1,3-benzodioxin-8-yl)ethan-1-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethanamine (CAS 910400-40-7) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: 2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethanamine. InChIKey: KJXOORGVJXTGTH-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethanamine |
| InChIKey | KJXOORGVJXTGTH-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)CCN)OCO1 |
Computed by PubChem (NCBI)