CAS 91047-79-9 is the registry number for (E)–3–(3–ethoxy–3–oxoprop–1–en–1–yl)benzoic acid. Offered by: GLPBio. Available pack sizes: 200mg.
3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoic acid (CAS 91047-79-9) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoic acid. InChIKey: VQKMUYLJAOIAHQ-VOTSOKGWSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 3-[(E)-3-ethoxy-3-oxoprop-1-enyl]benzoic acid |
| InChIKey | VQKMUYLJAOIAHQ-VOTSOKGWSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC(=CC=C1)C(=O)O |
Computed by PubChem (NCBI)