Products 91085-55-1
CAS 91085-55-1 is the registry number for Methyl 2-chloro-2-(3-chlorophenyl)acetate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Methyl 2-chloro-2-(3-chlorophenyl)acetate (CAS 91085-55-1) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: methyl 2-chloro-2-(3-chlorophenyl)acetate. InChIKey: XVNGCYNGUGKRFR-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | methyl 2-chloro-2-(3-chlorophenyl)acetate |
| InChIKey | XVNGCYNGUGKRFR-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)